C34H31N2O+ — CID 166051829
4-(2-cyclopentyl-1,1,3,3-tetradeuterio-2H-inden-4-yl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile (PubChem CID 166051829) has the molecular formula C34H31N2O+ and a molecular weight of 487.66 g/mol. Its IUPAC name is 4-(2-cyclopentyl-1,1,3,3-tetradeuterio-2H-inden-4-yl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile.
| Compound Name | 4-(2-cyclopentyl-1,1,3,3-tetradeuterio-2H-inden-4-yl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 166051829 |
| Molecular Formula | C34H31N2O+ |
| Molecular Weight | 487.66 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | 4-(2-cyclopentyl-1,1,3,3-tetradeuterio-2H-inden-4-yl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile |
| SMILES | [2H]C1([2H])c2cccc(-c3c(C#N)ccc4c3oc3c(-c5cccc[n+]5C)c(C)ccc34)c2C([2H])([2H])C1C1CCCC1 |
| InChI | InChI=1S/C34H31N2O/c1-21-13-15-27-28-16-14-24(20-35)32(34(28)37-33(27)31(21)30-12-5-6-17-36(30)2)26-11-7-10-23-18-25(19-29(23)26)22-8-3-4-9-22/h5-7,10-17,22,25H,3-4,8-9,18-19H2,1-2H3/q+1/i18D2,19D2 |
| InChIKey | ILDXHMKIZAKLSL-AUZVCRNNSA-N |
| XLogP | 7.83 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.66 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|