C28H24FN2O+ — CID 166051306
5-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-1-methyl-2,3-dihydroindole (PubChem CID 166051306) has the molecular formula C28H24FN2O+ and a molecular weight of 423.51 g/mol. Its IUPAC name is 5-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-1-methyl-2,3-dihydroindole.
| Compound Name | 5-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-1-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 166051306 |
| Molecular Formula | C28H24FN2O+ |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 5-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-1-methyl-2,3-dihydroindole |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5c(c4)CCN5C)c(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C28H24FN2O/c1-17-7-9-20-21-10-11-22(29)26(19-8-12-23-18(16-19)13-15-31(23)3)28(21)32-27(20)25(17)24-6-4-5-14-30(24)2/h4-12,14,16H,13,15H2,1-3H3/q+1 |
| InChIKey | RWXRQXWTCFRUDG-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|