C35H30FN2O+ — CID 166051128
3-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-9,9,10-trimethylacridine (PubChem CID 166051128) has the molecular formula C35H30FN2O+ and a molecular weight of 513.64 g/mol. Its IUPAC name is 3-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-9,9,10-trimethylacridine.
| Compound Name | 3-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-9,9,10-trimethylacridine |
|---|---|
| PubChem CID | 166051128 |
| Molecular Formula | C35H30FN2O+ |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 3-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-9,9,10-trimethylacridine |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5c(c4)N(C)c4ccccc4C5(C)C)c(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C35H30FN2O/c1-21-13-15-23-24-16-18-27(36)32(34(24)39-33(23)31(21)29-12-8-9-19-37(29)4)22-14-17-26-30(20-22)38(5)28-11-7-6-10-25(28)35(26,2)3/h6-20H,1-5H3/q+1 |
| InChIKey | TZQCCPHQNOZDAM-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|