C36H33FNOSi+ — CID 166051944
2-[7-fluoro-3-methyl-6-(5,5,10,10-tetramethylbenzo[b][1]benzosilin-2-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166051944) has the molecular formula C36H33FNOSi+ and a molecular weight of 542.75 g/mol. Its IUPAC name is 2-[7-fluoro-3-methyl-6-(5,5,10,10-tetramethylbenzo[b][1]benzosilin-2-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[7-fluoro-3-methyl-6-(5,5,10,10-tetramethylbenzo[b][1]benzosilin-2-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166051944 |
| Molecular Formula | C36H33FNOSi+ |
| Molecular Weight | 542.75 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 2-[7-fluoro-3-methyl-6-(5,5,10,10-tetramethylbenzo[b][1]benzosilin-2-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5c(c4)C(C)(C)c4ccccc4[Si]5(C)C)c(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C36H33FNOSi/c1-22-14-16-24-25-17-18-28(37)33(35(25)39-34(24)32(22)29-12-9-10-20-38(29)4)23-15-19-31-27(21-23)36(2,3)26-11-7-8-13-30(26)40(31,5)6/h7-21H,1-6H3/q+1 |
| InChIKey | WSCSWMSQNTXYTK-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.75 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|