C34H27FNO2+ — CID 166051552
2-[6-(9,9-dimethylxanthen-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166051552) has the molecular formula C34H27FNO2+ and a molecular weight of 500.59 g/mol. Its IUPAC name is 2-[6-(9,9-dimethylxanthen-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-(9,9-dimethylxanthen-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166051552 |
| Molecular Formula | C34H27FNO2+ |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 2-[6-(9,9-dimethylxanthen-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5c(c4)C(C)(C)c4ccccc4O5)c(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C34H27FNO2/c1-20-12-14-22-23-15-16-26(35)31(33(23)38-32(22)30(20)27-10-7-8-18-36(27)4)21-13-17-29-25(19-21)34(2,3)24-9-5-6-11-28(24)37-29/h5-19H,1-4H3/q+1 |
| InChIKey | AUYZUQLKTUSHDI-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 26.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|