C29H26FN2O+ — CID 166051850
7-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-1-methyl-3,4-dihydro-2H-quinoline (PubChem CID 166051850) has the molecular formula C29H26FN2O+ and a molecular weight of 437.54 g/mol. Its IUPAC name is 7-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-1-methyl-3,4-dihydro-2H-quinoline.
| Compound Name | 7-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-1-methyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 166051850 |
| Molecular Formula | C29H26FN2O+ |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 7-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-1-methyl-3,4-dihydro-2H-quinoline |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5c(c4)N(C)CCC5)c(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C29H26FN2O/c1-18-9-12-21-22-13-14-23(30)27(20-11-10-19-7-6-16-32(3)25(19)17-20)29(22)33-28(21)26(18)24-8-4-5-15-31(24)2/h4-5,8-15,17H,6-7,16H2,1-3H3/q+1 |
| InChIKey | RZUSRSUCONNLOL-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|