C30H26N3O+ — CID 166051722
7-methyl-4-(1-methyl-3,4-dihydro-2H-quinolin-7-yl)-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile (PubChem CID 166051722) has the molecular formula C30H26N3O+ and a molecular weight of 444.56 g/mol. Its IUPAC name is 7-methyl-4-(1-methyl-3,4-dihydro-2H-quinolin-7-yl)-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile.
| Compound Name | 7-methyl-4-(1-methyl-3,4-dihydro-2H-quinolin-7-yl)-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 166051722 |
| Molecular Formula | C30H26N3O+ |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 7-methyl-4-(1-methyl-3,4-dihydro-2H-quinolin-7-yl)-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5c(c4)N(C)CCC5)c(C#N)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C30H26N3O/c1-19-9-13-23-24-14-12-22(18-31)28(21-11-10-20-7-6-16-33(3)26(20)17-21)30(24)34-29(23)27(19)25-8-4-5-15-32(25)2/h4-5,8-15,17H,6-7,16H2,1-3H3/q+1 |
| InChIKey | FTBVOTMTTCELQS-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 44.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|