C37H40NO+ — CID 166051531
2-[6-[7-(1-deuteriocyclopentyl)-1,1,3,3-tetramethyl-2H-inden-4-yl]-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166051531) has the molecular formula C37H40NO+ and a molecular weight of 515.74 g/mol. Its IUPAC name is 2-[6-[7-(1-deuteriocyclopentyl)-1,1,3,3-tetramethyl-2H-inden-4-yl]-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-[7-(1-deuteriocyclopentyl)-1,1,3,3-tetramethyl-2H-inden-4-yl]-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166051531 |
| Molecular Formula | C37H40NO+ |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.32 |
| IUPAC Name | 2-[6-[7-(1-deuteriocyclopentyl)-1,1,3,3-tetramethyl-2H-inden-4-yl]-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [2H]C1(c2ccc(-c3cccc4c3oc3c(-c5cccc[n+]5C)c(C)ccc34)c3c2C(C)(C)CC3(C)C)CCCC1 |
| InChI | InChI=1S/C37H40NO/c1-23-17-18-29-28-15-11-14-27(34(28)39-35(29)31(23)30-16-9-10-21-38(30)6)26-20-19-25(24-12-7-8-13-24)32-33(26)37(4,5)22-36(32,2)3/h9-11,14-21,24H,7-8,12-13,22H2,1-6H3/q+1/i24D |
| InChIKey | ISRZNKXRDSDKAF-CORJAIEOSA-N |
| XLogP | 9.67 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|