C30H30NO+ — CID 166050979
2-[6-(1,1-dimethyl-4,5,6,7-tetrahydroinden-2-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166050979) has the molecular formula C30H30NO+ and a molecular weight of 420.58 g/mol. Its IUPAC name is 2-[6-(1,1-dimethyl-4,5,6,7-tetrahydroinden-2-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-(1,1-dimethyl-4,5,6,7-tetrahydroinden-2-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166050979 |
| Molecular Formula | C30H30NO+ |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 2-[6-(1,1-dimethyl-4,5,6,7-tetrahydroinden-2-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(C4=CC5=C(CCCC5)C4(C)C)cccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C30H30NO/c1-19-15-16-22-21-11-9-12-23(25-18-20-10-5-6-13-24(20)30(25,2)3)28(21)32-29(22)27(19)26-14-7-8-17-31(26)4/h7-9,11-12,14-18H,5-6,10,13H2,1-4H3/q+1 |
| InChIKey | MMQTVUGXDVUBNK-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|