C32H32NO+ — CID 155648896
1-methyl-2-[2-methyl-7,7-di(propan-2-yl)fluoreno[4,3-b][1]benzofuran-1-yl]pyridin-1-ium (PubChem CID 155648896) has the molecular formula C32H32NO+ and a molecular weight of 446.61 g/mol. Its IUPAC name is 1-methyl-2-[2-methyl-7,7-di(propan-2-yl)fluoreno[4,3-b][1]benzofuran-1-yl]pyridin-1-ium.
| Compound Name | 1-methyl-2-[2-methyl-7,7-di(propan-2-yl)fluoreno[4,3-b][1]benzofuran-1-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 155648896 |
| Molecular Formula | C32H32NO+ |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 1-methyl-2-[2-methyl-7,7-di(propan-2-yl)fluoreno[4,3-b][1]benzofuran-1-yl]pyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c4c(ccc32)C(C(C)C)(C(C)C)c2ccccc2-4)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C32H32NO/c1-19(2)32(20(3)4)25-12-8-7-11-24(25)29-26(32)17-16-23-22-15-14-21(5)28(30(22)34-31(23)29)27-13-9-10-18-33(27)6/h7-20H,1-6H3/q+1 |
| InChIKey | IMRQROZIBGGTIJ-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|