C21H21N2O+ — CID 123821862
7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-propan-2-yl-[1]benzofuro[3,2-c]pyridine (PubChem CID 123821862) has the molecular formula C21H21N2O+ and a molecular weight of 317.41 g/mol. Its IUPAC name is 7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-propan-2-yl-[1]benzofuro[3,2-c]pyridine.
| Compound Name | 7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-propan-2-yl-[1]benzofuro[3,2-c]pyridine |
|---|---|
| PubChem CID | 123821862 |
| Molecular Formula | C21H21N2O+ |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-propan-2-yl-[1]benzofuro[3,2-c]pyridine |
| SMILES | Cc1ccc2c(oc3c(C(C)C)cncc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C21H21N2O/c1-13(2)16-11-22-12-17-15-9-8-14(3)19(21(15)24-20(16)17)18-7-5-6-10-23(18)4/h5-13H,1-4H3/q+1 |
| InChIKey | ZLPUQZFQQCOYJH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|