C23H21N2O+ — CID 170252370
7-methyl-6-(1-methylpyridin-1-ium-2-yl)-3-propan-2-yldibenzofuran-4-carbonitrile (PubChem CID 170252370) has the molecular formula C23H21N2O+ and a molecular weight of 341.43 g/mol. Its IUPAC name is 7-methyl-6-(1-methylpyridin-1-ium-2-yl)-3-propan-2-yldibenzofuran-4-carbonitrile.
| Compound Name | 7-methyl-6-(1-methylpyridin-1-ium-2-yl)-3-propan-2-yldibenzofuran-4-carbonitrile |
|---|---|
| PubChem CID | 170252370 |
| Molecular Formula | C23H21N2O+ |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 7-methyl-6-(1-methylpyridin-1-ium-2-yl)-3-propan-2-yldibenzofuran-4-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(C#N)c(C(C)C)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C23H21N2O/c1-14(2)16-10-11-17-18-9-8-15(3)21(20-7-5-6-12-25(20)4)23(18)26-22(17)19(16)13-24/h5-12,14H,1-4H3/q+1 |
| InChIKey | BMVKZXBNVYQTAX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|