C22H24NOSi+ — CID 167358131
trimethyl-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-yl]silane (PubChem CID 167358131) has the molecular formula C22H24NOSi+ and a molecular weight of 346.53 g/mol. Its IUPAC name is trimethyl-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-yl]silane.
| Compound Name | trimethyl-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-yl]silane |
|---|---|
| PubChem CID | 167358131 |
| Molecular Formula | C22H24NOSi+ |
| Molecular Weight | 346.53 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | trimethyl-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-yl]silane |
| SMILES | Cc1ccc2c(oc3cc([Si](C)(C)C)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C22H24NOSi/c1-15-9-11-18-17-12-10-16(25(3,4)5)14-20(17)24-22(18)21(15)19-8-6-7-13-23(19)2/h6-14H,1-5H3/q+1 |
| InChIKey | PKGOTUAKPFXCIE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|