C18H14FN2O+ — CID 123627897
2-fluoro-7-methyl-8-(1-methylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 123627897) has the molecular formula C18H14FN2O+ and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-fluoro-7-methyl-8-(1-methylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2-fluoro-7-methyl-8-(1-methylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 123627897 |
| Molecular Formula | C18H14FN2O+ |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 2-fluoro-7-methyl-8-(1-methylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(oc3nc(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C18H14FN2O/c1-11-6-7-12-13-8-9-15(19)20-18(13)22-17(12)16(11)14-5-3-4-10-21(14)2/h3-10H,1-2H3/q+1 |
| InChIKey | PEJSFFRZYIJEFV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|