C34H30FN2O+ — CID 164849663
2-[4-(3-tert-butylphenyl)phenyl]-3-fluoro-7-methyl-8-(1-methylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 164849663) has the molecular formula C34H30FN2O+ and a molecular weight of 501.63 g/mol. Its IUPAC name is 2-[4-(3-tert-butylphenyl)phenyl]-3-fluoro-7-methyl-8-(1-methylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2-[4-(3-tert-butylphenyl)phenyl]-3-fluoro-7-methyl-8-(1-methylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 164849663 |
| Molecular Formula | C34H30FN2O+ |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 2-[4-(3-tert-butylphenyl)phenyl]-3-fluoro-7-methyl-8-(1-methylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(oc3nc(-c4ccc(-c5cccc(C(C)(C)C)c5)cc4)c(F)cc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C34H30FN2O/c1-21-12-17-26-27-20-28(35)31(36-33(27)38-32(26)30(21)29-11-6-7-18-37(29)5)23-15-13-22(14-16-23)24-9-8-10-25(19-24)34(2,3)4/h6-20H,1-5H3/q+1 |
| InChIKey | FXQJXPHCQONDRR-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|