C19H15N2O+ — CID 162283083
5-methyl-6-(1-methylpyridin-1-ium-2-yl)-8-oxa-10-azatetracyclo[7.5.0.02,7.011,13]tetradeca-1(9),2(7),3,5,10,13-hexaene (PubChem CID 162283083) has the molecular formula C19H15N2O+ and a molecular weight of 287.34 g/mol. Its IUPAC name is 5-methyl-6-(1-methylpyridin-1-ium-2-yl)-8-oxa-10-azatetracyclo[7.5.0.02,7.011,13]tetradeca-1(9),2(7),3,5,10,13-hexaene.
| Compound Name | 5-methyl-6-(1-methylpyridin-1-ium-2-yl)-8-oxa-10-azatetracyclo[7.5.0.02,7.011,13]tetradeca-1(9),2(7),3,5,10,13-hexaene |
|---|---|
| PubChem CID | 162283083 |
| Molecular Formula | C19H15N2O+ |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 5-methyl-6-(1-methylpyridin-1-ium-2-yl)-8-oxa-10-azatetracyclo[7.5.0.02,7.011,13]tetradeca-1(9),2(7),3,5,10,13-hexaene |
| SMILES | Cc1ccc2c(oc3nc4c(cc32)C4)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C19H15N2O/c1-11-6-7-13-14-9-12-10-15(12)20-19(14)22-18(13)17(11)16-5-3-4-8-21(16)2/h3-9H,10H2,1-2H3/q+1 |
| InChIKey | MULCDZHNUNOMQJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|