C33H34NO+ — CID 159200392
2-[7-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-methyl-7-(1,1,1,2-tetradeuteriopropan-2-yl)fluoreno[4,3-b][1]benzofuran-1-yl]-1-methyl-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 159200392) has the molecular formula C33H34NO+ and a molecular weight of 474.73 g/mol. Its IUPAC name is 2-[7-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-methyl-7-(1,1,1,2-tetradeuteriopropan-2-yl)fluoreno[4,3-b][1]benzofuran-1-yl]-1-methyl-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 2-[7-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-methyl-7-(1,1,1,2-tetradeuteriopropan-2-yl)fluoreno[4,3-b][1]benzofuran-1-yl]-1-methyl-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 159200392 |
| Molecular Formula | C33H34NO+ |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.35 |
| IUPAC Name | 2-[7-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-methyl-7-(1,1,1,2-tetradeuteriopropan-2-yl)fluoreno[4,3-b][1]benzofuran-1-yl]-1-methyl-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2c(C)ccc3c2oc2c4c(ccc23)C(C([2H])(C)C([2H])([2H])[2H])(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c2ccccc2-4)[n+](C)c1 |
| InChI | InChI=1S/C33H34NO/c1-19(2)33(20(3)4)26-11-9-8-10-25(26)30-27(33)16-15-24-23-14-13-22(6)29(31(23)35-32(24)30)28-17-12-21(5)18-34(28)7/h8-20H,1-7H3/q+1/i1D3,2D3,3D3,5D3,19D,20D |
| InChIKey | JYGLJZGVPJKSMY-YJBPDVPVSA-N |
| XLogP | 8.27 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|