C28H25N2O+ — CID 156661836
17-methyl-18-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-10,10-bis(trideuteriomethyl)-20-oxa-8-azapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaene (PubChem CID 156661836) has the molecular formula C28H25N2O+ and a molecular weight of 414.58 g/mol. Its IUPAC name is 17-methyl-18-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-10,10-bis(trideuteriomethyl)-20-oxa-8-azapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaene.
| Compound Name | 17-methyl-18-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-10,10-bis(trideuteriomethyl)-20-oxa-8-azapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaene |
|---|---|
| PubChem CID | 156661836 |
| Molecular Formula | C28H25N2O+ |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 17-methyl-18-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-10,10-bis(trideuteriomethyl)-20-oxa-8-azapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaene |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2c(C)ccc3c2oc2cc4c(cc23)C(C([2H])([2H])[2H])(C([2H])([2H])[2H])c2ncccc2-4)[n+](C)c1 |
| InChI | InChI=1S/C28H25N2O/c1-16-8-11-23(30(5)15-16)25-17(2)9-10-18-21-13-22-20(14-24(21)31-26(18)25)19-7-6-12-29-27(19)28(22,3)4/h6-15H,1-5H3/q+1/i1D3,3D3,4D3 |
| InChIKey | SXGOHVMTFSEUSP-MXOMHCEVSA-N |
| XLogP | 6.40 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|