C26H23N2O+ — CID 157110962
2,7-dimethyl-8-[1-methyl-5-[4-(trideuteriomethyl)phenyl]pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 157110962) has the molecular formula C26H23N2O+ and a molecular weight of 382.50 g/mol. Its IUPAC name is 2,7-dimethyl-8-[1-methyl-5-[4-(trideuteriomethyl)phenyl]pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2,7-dimethyl-8-[1-methyl-5-[4-(trideuteriomethyl)phenyl]pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 157110962 |
| Molecular Formula | C26H23N2O+ |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2,7-dimethyl-8-[1-methyl-5-[4-(trideuteriomethyl)phenyl]pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2ccc(-c3c(C)ccc4c3oc3nc(C)ccc34)[n+](C)c2)cc1 |
| InChI | InChI=1S/C26H23N2O/c1-16-5-9-19(10-6-16)20-11-14-23(28(4)15-20)24-17(2)7-12-21-22-13-8-18(3)27-26(22)29-25(21)24/h5-15H,1-4H3/q+1/i1D3 |
| InChIKey | KKWIMDSYWCIZPS-FIBGUPNXSA-N |
| XLogP | 6.06 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|