C21H21N2O+ — CID 161347793
2,5,7-trimethyl-8-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 161347793) has the molecular formula C21H21N2O+ and a molecular weight of 320.43 g/mol. Its IUPAC name is 2,5,7-trimethyl-8-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2,5,7-trimethyl-8-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 161347793 |
| Molecular Formula | C21H21N2O+ |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2,5,7-trimethyl-8-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2c(C)cc(C)c3c2oc2nc(C)ccc23)[n+](C)c1 |
| InChI | InChI=1S/C21H21N2O/c1-12-6-9-17(23(5)11-12)19-14(3)10-13(2)18-16-8-7-15(4)22-21(16)24-20(18)19/h6-11H,1-5H3/q+1/i1D3 |
| InChIKey | XQPUPVKISLALMU-FIBGUPNXSA-N |
| XLogP | 4.71 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|