C34H36NO+ — CID 157329000
4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-[2-methyl-7,7-bis(2,2,2-trideuterioethyl)fluoreno[4,3-b][1]benzofuran-1-yl]-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 157329000) has the molecular formula C34H36NO+ and a molecular weight of 490.77 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-[2-methyl-7,7-bis(2,2,2-trideuterioethyl)fluoreno[4,3-b][1]benzofuran-1-yl]-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-[2-methyl-7,7-bis(2,2,2-trideuterioethyl)fluoreno[4,3-b][1]benzofuran-1-yl]-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 157329000 |
| Molecular Formula | C34H36NO+ |
| Molecular Weight | 490.77 g/mol |
| Exact Mass | 490.38 |
| IUPAC Name | 4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-[2-methyl-7,7-bis(2,2,2-trideuterioethyl)fluoreno[4,3-b][1]benzofuran-1-yl]-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])CC1(CC([2H])([2H])[2H])c2ccccc2-c2c1ccc1c2oc2c(-c3cc(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c(C([2H])([2H])[2H])c[n+]3C)c(C)ccc21 |
| InChI | InChI=1S/C34H36NO/c1-8-34(9-2)27-13-11-10-12-25(27)31-28(34)17-16-24-23-15-14-21(5)30(32(23)36-33(24)31)29-18-26(20(3)4)22(6)19-35(29)7/h10-20H,8-9H2,1-7H3/q+1/i1D3,2D3,3D3,4D3,6D3,20D |
| InChIKey | IIKFCNRPHSHSQK-FEKYBFLDSA-N |
| XLogP | 8.90 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.77 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|