C38H32FN2O+ — CID 169283139
4-(9,9-dimethylfluoren-2-yl)-6-[5-fluoro-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-7-methyldibenzofuran-1-carbonitrile (PubChem CID 169283139) has the molecular formula C38H32FN2O+ and a molecular weight of 558.73 g/mol. Its IUPAC name is 4-(9,9-dimethylfluoren-2-yl)-6-[5-fluoro-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-7-methyldibenzofuran-1-carbonitrile.
| Compound Name | 4-(9,9-dimethylfluoren-2-yl)-6-[5-fluoro-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-7-methyldibenzofuran-1-carbonitrile |
|---|---|
| PubChem CID | 169283139 |
| Molecular Formula | C38H32FN2O+ |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | 4-(9,9-dimethylfluoren-2-yl)-6-[5-fluoro-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-7-methyldibenzofuran-1-carbonitrile |
| SMILES | [2H]C([2H])([2H])C([2H])(c1cc(-c2c(C)ccc3c2oc2c(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)ccc(C#N)c23)[n+](C)cc1F)C([2H])([2H])[2H] |
| InChI | InChI=1S/C38H32FN2O/c1-21(2)29-18-33(41(6)20-32(29)39)34-22(3)11-14-28-35-24(19-40)13-15-25(36(35)42-37(28)34)23-12-16-27-26-9-7-8-10-30(26)38(4,5)31(27)17-23/h7-18,20-21H,1-6H3/q+1/i1D3,2D3,21D |
| InChIKey | PVMMMQPOJIXDQN-PRCNHKIYSA-N |
| XLogP | 9.49 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|