C33H26FN2O+ — CID 169282786
6-[5-fluoro-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-7-methyl-4-naphthalen-2-yldibenzofuran-2-carbonitrile (PubChem CID 169282786) has the molecular formula C33H26FN2O+ and a molecular weight of 492.62 g/mol. Its IUPAC name is 6-[5-fluoro-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-7-methyl-4-naphthalen-2-yldibenzofuran-2-carbonitrile.
| Compound Name | 6-[5-fluoro-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-7-methyl-4-naphthalen-2-yldibenzofuran-2-carbonitrile |
|---|---|
| PubChem CID | 169282786 |
| Molecular Formula | C33H26FN2O+ |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 6-[5-fluoro-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-7-methyl-4-naphthalen-2-yldibenzofuran-2-carbonitrile |
| SMILES | [2H]C([2H])([2H])C([2H])(c1cc(-c2c(C)ccc3c2oc2c(-c4ccc5ccccc5c4)cc(C#N)cc23)[n+](C)cc1F)C([2H])([2H])[2H] |
| InChI | InChI=1S/C33H26FN2O/c1-19(2)26-16-30(36(4)18-29(26)34)31-20(3)9-12-25-28-14-21(17-35)13-27(32(28)37-33(25)31)24-11-10-22-7-5-6-8-23(22)15-24/h5-16,18-19H,1-4H3/q+1/i1D3,2D3,19D |
| InChIKey | KJHMACFSALIJNH-HXAWLNHQSA-N |
| XLogP | 8.34 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|