C31H22FN2O+ — CID 169282934
6-(5-fluoro-1,4-dimethylpyridin-1-ium-2-yl)-7-methyl-4-naphthalen-2-yldibenzofuran-2-carbonitrile (PubChem CID 169282934) has the molecular formula C31H22FN2O+ and a molecular weight of 457.53 g/mol. Its IUPAC name is 6-(5-fluoro-1,4-dimethylpyridin-1-ium-2-yl)-7-methyl-4-naphthalen-2-yldibenzofuran-2-carbonitrile.
| Compound Name | 6-(5-fluoro-1,4-dimethylpyridin-1-ium-2-yl)-7-methyl-4-naphthalen-2-yldibenzofuran-2-carbonitrile |
|---|---|
| PubChem CID | 169282934 |
| Molecular Formula | C31H22FN2O+ |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 6-(5-fluoro-1,4-dimethylpyridin-1-ium-2-yl)-7-methyl-4-naphthalen-2-yldibenzofuran-2-carbonitrile |
| SMILES | Cc1cc(-c2c(C)ccc3c2oc2c(-c4ccc5ccccc5c4)cc(C#N)cc23)[n+](C)cc1F |
| InChI | InChI=1S/C31H22FN2O/c1-18-8-11-24-26-14-20(16-33)13-25(23-10-9-21-6-4-5-7-22(21)15-23)30(26)35-31(24)29(18)28-12-19(2)27(32)17-34(28)3/h4-15,17H,1-3H3/q+1 |
| InChIKey | SDVMXDIHSKKLHG-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|