C35H31N2O+ — CID 164850024
6-[4-(2,2-dimethylpropyl)-1-methylpyridin-1-ium-2-yl]-7-methyl-3-naphthalen-2-yldibenzofuran-4-carbonitrile (PubChem CID 164850024) has the molecular formula C35H31N2O+ and a molecular weight of 495.65 g/mol. Its IUPAC name is 6-[4-(2,2-dimethylpropyl)-1-methylpyridin-1-ium-2-yl]-7-methyl-3-naphthalen-2-yldibenzofuran-4-carbonitrile.
| Compound Name | 6-[4-(2,2-dimethylpropyl)-1-methylpyridin-1-ium-2-yl]-7-methyl-3-naphthalen-2-yldibenzofuran-4-carbonitrile |
|---|---|
| PubChem CID | 164850024 |
| Molecular Formula | C35H31N2O+ |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 6-[4-(2,2-dimethylpropyl)-1-methylpyridin-1-ium-2-yl]-7-methyl-3-naphthalen-2-yldibenzofuran-4-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(C#N)c(-c4ccc5ccccc5c4)ccc32)c1-c1cc(CC(C)(C)C)cc[n+]1C |
| InChI | InChI=1S/C35H31N2O/c1-22-10-13-29-28-15-14-27(26-12-11-24-8-6-7-9-25(24)19-26)30(21-36)33(28)38-34(29)32(22)31-18-23(16-17-37(31)5)20-35(2,3)4/h6-19H,20H2,1-5H3/q+1 |
| InChIKey | JQOHZALNVJOQNX-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|