C34H32NO+ — CID 167357541
4-(2,2-dimethylpropyl)-1-methyl-2-(3-methyl-6-naphthalen-2-yldibenzofuran-4-yl)pyridin-1-ium (PubChem CID 167357541) has the molecular formula C34H32NO+ and a molecular weight of 470.64 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-1-methyl-2-(3-methyl-6-naphthalen-2-yldibenzofuran-4-yl)pyridin-1-ium.
| Compound Name | 4-(2,2-dimethylpropyl)-1-methyl-2-(3-methyl-6-naphthalen-2-yldibenzofuran-4-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 167357541 |
| Molecular Formula | C34H32NO+ |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-1-methyl-2-(3-methyl-6-naphthalen-2-yldibenzofuran-4-yl)pyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5ccccc5c4)cccc32)c1-c1cc(CC(C)(C)C)cc[n+]1C |
| InChI | InChI=1S/C34H32NO/c1-22-13-16-29-28-12-8-11-27(26-15-14-24-9-6-7-10-25(24)20-26)32(28)36-33(29)31(22)30-19-23(17-18-35(30)5)21-34(2,3)4/h6-20H,21H2,1-5H3/q+1 |
| InChIKey | LPTOLCYLSOKRKK-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|