C33H34NO+ — CID 167357812
4-(2,2-dimethylpropyl)-1-methyl-2-(3,11,11-trimethylfluoreno[3,2-b][1]benzofuran-4-yl)pyridin-1-ium (PubChem CID 167357812) has the molecular formula C33H34NO+ and a molecular weight of 460.64 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-1-methyl-2-(3,11,11-trimethylfluoreno[3,2-b][1]benzofuran-4-yl)pyridin-1-ium.
| Compound Name | 4-(2,2-dimethylpropyl)-1-methyl-2-(3,11,11-trimethylfluoreno[3,2-b][1]benzofuran-4-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 167357812 |
| Molecular Formula | C33H34NO+ |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-1-methyl-2-(3,11,11-trimethylfluoreno[3,2-b][1]benzofuran-4-yl)pyridin-1-ium |
| SMILES | Cc1ccc2c(oc3cc4c(cc32)C(C)(C)c2ccccc2-4)c1-c1cc(CC(C)(C)C)cc[n+]1C |
| InChI | InChI=1S/C33H34NO/c1-20-12-13-23-25-17-27-24(22-10-8-9-11-26(22)33(27,5)6)18-29(25)35-31(23)30(20)28-16-21(14-15-34(28)7)19-32(2,3)4/h8-18H,19H2,1-7H3/q+1 |
| InChIKey | ISEVLQSIAFKFGL-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|