C31H30NO+ — CID 155648800
1-methyl-4-propan-2-yl-2-(3,11,11-trimethylfluoreno[3,2-b][1]benzofuran-4-yl)pyridin-1-ium (PubChem CID 155648800) has the molecular formula C31H30NO+ and a molecular weight of 432.59 g/mol. Its IUPAC name is 1-methyl-4-propan-2-yl-2-(3,11,11-trimethylfluoreno[3,2-b][1]benzofuran-4-yl)pyridin-1-ium.
| Compound Name | 1-methyl-4-propan-2-yl-2-(3,11,11-trimethylfluoreno[3,2-b][1]benzofuran-4-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 155648800 |
| Molecular Formula | C31H30NO+ |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1-methyl-4-propan-2-yl-2-(3,11,11-trimethylfluoreno[3,2-b][1]benzofuran-4-yl)pyridin-1-ium |
| SMILES | Cc1ccc2c(oc3cc4c(cc32)C(C)(C)c2ccccc2-4)c1-c1cc(C(C)C)cc[n+]1C |
| InChI | InChI=1S/C31H30NO/c1-18(2)20-13-14-32(6)27(15-20)29-19(3)11-12-22-24-16-26-23(17-28(24)33-30(22)29)21-9-7-8-10-25(21)31(26,4)5/h7-18H,1-6H3/q+1 |
| InChIKey | OZFUWNDOHCGJQV-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|