C35H38NO+ — CID 155648722
1,4-dimethyl-2-[3-methyl-11,11-bis(2-methylpropyl)fluoreno[3,2-b][1]benzofuran-4-yl]pyridin-1-ium (PubChem CID 155648722) has the molecular formula C35H38NO+ and a molecular weight of 488.70 g/mol. Its IUPAC name is 1,4-dimethyl-2-[3-methyl-11,11-bis(2-methylpropyl)fluoreno[3,2-b][1]benzofuran-4-yl]pyridin-1-ium.
| Compound Name | 1,4-dimethyl-2-[3-methyl-11,11-bis(2-methylpropyl)fluoreno[3,2-b][1]benzofuran-4-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 155648722 |
| Molecular Formula | C35H38NO+ |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 1,4-dimethyl-2-[3-methyl-11,11-bis(2-methylpropyl)fluoreno[3,2-b][1]benzofuran-4-yl]pyridin-1-ium |
| SMILES | Cc1cc[n+](C)c(-c2c(C)ccc3c2oc2cc4c(cc23)C(CC(C)C)(CC(C)C)c2ccccc2-4)c1 |
| InChI | InChI=1S/C35H38NO/c1-21(2)19-35(20-22(3)4)29-11-9-8-10-25(29)27-18-32-28(17-30(27)35)26-13-12-24(6)33(34(26)37-32)31-16-23(5)14-15-36(31)7/h8-18,21-22H,19-20H2,1-7H3/q+1 |
| InChIKey | ILNWDXMRTNBEFZ-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|