C37H42NO+ — CID 156661769
2-[7,7-bis(2,2-dimethylpropyl)-3-methylfluoreno[2,3-b][1]benzofuran-4-yl]-1,4-dimethylpyridin-1-ium (PubChem CID 156661769) has the molecular formula C37H42NO+ and a molecular weight of 516.75 g/mol. Its IUPAC name is 2-[7,7-bis(2,2-dimethylpropyl)-3-methylfluoreno[2,3-b][1]benzofuran-4-yl]-1,4-dimethylpyridin-1-ium.
| Compound Name | 2-[7,7-bis(2,2-dimethylpropyl)-3-methylfluoreno[2,3-b][1]benzofuran-4-yl]-1,4-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 156661769 |
| Molecular Formula | C37H42NO+ |
| Molecular Weight | 516.75 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | 2-[7,7-bis(2,2-dimethylpropyl)-3-methylfluoreno[2,3-b][1]benzofuran-4-yl]-1,4-dimethylpyridin-1-ium |
| SMILES | Cc1cc[n+](C)c(-c2c(C)ccc3c2oc2cc4c(cc23)-c2ccccc2C4(CC(C)(C)C)CC(C)(C)C)c1 |
| InChI | InChI=1S/C37H42NO/c1-23-16-17-38(9)31(18-23)33-24(2)14-15-26-28-19-27-25-12-10-11-13-29(25)37(21-35(3,4)5,22-36(6,7)8)30(27)20-32(28)39-34(26)33/h10-20H,21-22H2,1-9H3/q+1 |
| InChIKey | MRQOVDQWOCRPNU-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.75 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|