C38H44NO+ — CID 156661791
2-[7,7-bis(2,2-dimethylpropyl)-3-methylfluoreno[2,3-b][1]benzofuran-4-yl]-1,4,5-trimethylpyridin-1-ium (PubChem CID 156661791) has the molecular formula C38H44NO+ and a molecular weight of 530.78 g/mol. Its IUPAC name is 2-[7,7-bis(2,2-dimethylpropyl)-3-methylfluoreno[2,3-b][1]benzofuran-4-yl]-1,4,5-trimethylpyridin-1-ium.
| Compound Name | 2-[7,7-bis(2,2-dimethylpropyl)-3-methylfluoreno[2,3-b][1]benzofuran-4-yl]-1,4,5-trimethylpyridin-1-ium |
|---|---|
| PubChem CID | 156661791 |
| Molecular Formula | C38H44NO+ |
| Molecular Weight | 530.78 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | 2-[7,7-bis(2,2-dimethylpropyl)-3-methylfluoreno[2,3-b][1]benzofuran-4-yl]-1,4,5-trimethylpyridin-1-ium |
| SMILES | Cc1cc(-c2c(C)ccc3c2oc2cc4c(cc23)-c2ccccc2C4(CC(C)(C)C)CC(C)(C)C)[n+](C)cc1C |
| InChI | InChI=1S/C38H44NO/c1-23-15-16-27-29-18-28-26-13-11-12-14-30(26)38(21-36(4,5)6,22-37(7,8)9)31(28)19-33(29)40-35(27)34(23)32-17-24(2)25(3)20-39(32)10/h11-20H,21-22H2,1-10H3/q+1 |
| InChIKey | FURSYJKFEDBDPR-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.78 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|