C30H29N2O+ — CID 155648736
8-[4-(2-deuteriopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-7-methyl-14,14-bis(trideuteriomethyl)-10-oxa-12-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4(9),5,7,11,15,17,19-nonaene (PubChem CID 155648736) has the molecular formula C30H29N2O+ and a molecular weight of 440.62 g/mol. Its IUPAC name is 8-[4-(2-deuteriopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-7-methyl-14,14-bis(trideuteriomethyl)-10-oxa-12-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4(9),5,7,11,15,17,19-nonaene.
| Compound Name | 8-[4-(2-deuteriopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-7-methyl-14,14-bis(trideuteriomethyl)-10-oxa-12-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4(9),5,7,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 155648736 |
| Molecular Formula | C30H29N2O+ |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 8-[4-(2-deuteriopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-7-methyl-14,14-bis(trideuteriomethyl)-10-oxa-12-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4(9),5,7,11,15,17,19-nonaene |
| SMILES | [2H]C(C)(C)c1cc[n+](C)c(-c2c(C)ccc3c2oc2nc4c(cc23)-c2ccccc2C4(C([2H])([2H])[2H])C([2H])([2H])[2H])c1 |
| InChI | InChI=1S/C30H29N2O/c1-17(2)19-13-14-32(6)25(15-19)26-18(3)11-12-21-23-16-22-20-9-7-8-10-24(20)30(4,5)28(22)31-29(23)33-27(21)26/h7-17H,1-6H3/q+1/i4D3,5D3,17D |
| InChIKey | RQTQFOYDBOADSJ-LTXBSDFESA-N |
| XLogP | 7.21 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|