C22H22NO+ — CID 166512644
4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-(3-methyldibenzofuran-4-yl)pyridin-1-ium (PubChem CID 166512644) has the molecular formula C22H22NO+ and a molecular weight of 323.47 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-(3-methyldibenzofuran-4-yl)pyridin-1-ium.
| Compound Name | 4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-(3-methyldibenzofuran-4-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 166512644 |
| Molecular Formula | C22H22NO+ |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-(3-methyldibenzofuran-4-yl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])C([2H])(c1cc[n+](C)c(-c2c(C)ccc3c2oc2ccccc23)c1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C22H22NO/c1-14(2)16-11-12-23(4)19(13-16)21-15(3)9-10-18-17-7-5-6-8-20(17)24-22(18)21/h5-14H,1-4H3/q+1/i1D3,2D3,14D |
| InChIKey | YNMVYQJTPRZTGO-HSNISVEUSA-N |
| XLogP | 5.51 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|