C23H24NO+ — CID 159292455
4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-[3-methyl-1-(trideuteriomethyl)dibenzofuran-4-yl]pyridin-1-ium (PubChem CID 159292455) has the molecular formula C23H24NO+ and a molecular weight of 340.51 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-[3-methyl-1-(trideuteriomethyl)dibenzofuran-4-yl]pyridin-1-ium.
| Compound Name | 4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-[3-methyl-1-(trideuteriomethyl)dibenzofuran-4-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 159292455 |
| Molecular Formula | C23H24NO+ |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | 4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methyl-2-[3-methyl-1-(trideuteriomethyl)dibenzofuran-4-yl]pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cc(C)c(-c2cc(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])cc[n+]2C)c2oc3ccccc3c12 |
| InChI | InChI=1S/C23H24NO/c1-14(2)17-10-11-24(5)19(13-17)22-16(4)12-15(3)21-18-8-6-7-9-20(18)25-23(21)22/h6-14H,1-5H3/q+1/i1D3,2D3,3D3,14D |
| InChIKey | NDWCFSCIACTJPH-YEHLMPTHSA-N |
| XLogP | 5.82 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|