C22H18NO2+ — CID 158153176
1,4-dimethyl-2-(3-methyl-[1]benzofuro[2,3-b][1]benzofuran-4-yl)pyridin-1-ium (PubChem CID 158153176) has the molecular formula C22H18NO2+ and a molecular weight of 328.39 g/mol. Its IUPAC name is 1,4-dimethyl-2-(3-methyl-[1]benzofuro[2,3-b][1]benzofuran-4-yl)pyridin-1-ium.
| Compound Name | 1,4-dimethyl-2-(3-methyl-[1]benzofuro[2,3-b][1]benzofuran-4-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 158153176 |
| Molecular Formula | C22H18NO2+ |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 1,4-dimethyl-2-(3-methyl-[1]benzofuro[2,3-b][1]benzofuran-4-yl)pyridin-1-ium |
| SMILES | Cc1cc[n+](C)c(-c2c(C)ccc3c2oc2oc4ccccc4c23)c1 |
| InChI | InChI=1S/C22H18NO2/c1-13-10-11-23(3)17(12-13)19-14(2)8-9-16-20-15-6-4-5-7-18(15)24-22(20)25-21(16)19/h4-12H,1-3H3/q+1 |
| InChIKey | JEVDSGPURVRQMA-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 30.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|