C34H25FNO+ — CID 169077066
2-[6-(10-deuteriophenanthren-9-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1,4-dimethylpyridin-1-ium (PubChem CID 169077066) has the molecular formula C34H25FNO+ and a molecular weight of 483.58 g/mol. Its IUPAC name is 2-[6-(10-deuteriophenanthren-9-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1,4-dimethylpyridin-1-ium.
| Compound Name | 2-[6-(10-deuteriophenanthren-9-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1,4-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 169077066 |
| Molecular Formula | C34H25FNO+ |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 2-[6-(10-deuteriophenanthren-9-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1,4-dimethylpyridin-1-ium |
| SMILES | [2H]c1c(-c2c(F)ccc3c2oc2c(-c4cc(C)cc[n+]4C)c(C)ccc23)c2ccccc2c2ccccc12 |
| InChI | InChI=1S/C34H25FNO/c1-20-16-17-36(3)30(18-20)31-21(2)12-13-26-27-14-15-29(35)32(34(27)37-33(26)31)28-19-22-8-4-5-9-23(22)24-10-6-7-11-25(24)28/h4-19H,1-3H3/q+1/i19D |
| InChIKey | QMOLIYKFQCBEEM-YUIGOLOMSA-N |
| XLogP | 8.81 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|