C35H27FNO+ — CID 169077031
2-(7-fluoro-3-methyl-6-phenanthren-9-yldibenzofuran-4-yl)-1,4,5-trimethylpyridin-1-ium (PubChem CID 169077031) has the molecular formula C35H27FNO+ and a molecular weight of 496.61 g/mol. Its IUPAC name is 2-(7-fluoro-3-methyl-6-phenanthren-9-yldibenzofuran-4-yl)-1,4,5-trimethylpyridin-1-ium.
| Compound Name | 2-(7-fluoro-3-methyl-6-phenanthren-9-yldibenzofuran-4-yl)-1,4,5-trimethylpyridin-1-ium |
|---|---|
| PubChem CID | 169077031 |
| Molecular Formula | C35H27FNO+ |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 2-(7-fluoro-3-methyl-6-phenanthren-9-yldibenzofuran-4-yl)-1,4,5-trimethylpyridin-1-ium |
| SMILES | Cc1cc(-c2c(C)ccc3c2oc2c(-c4cc5ccccc5c5ccccc45)c(F)ccc23)[n+](C)cc1C |
| InChI | InChI=1S/C35H27FNO/c1-20-13-14-27-28-15-16-30(36)33(29-18-23-9-5-6-10-24(23)25-11-7-8-12-26(25)29)35(28)38-34(27)32(20)31-17-21(2)22(3)19-37(31)4/h5-19H,1-4H3/q+1 |
| InChIKey | JVBRIDLGWUSWJK-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|