C28H25N2O+ — CID 147816252
9,12-dimethyl-10-(1,4,5-trimethylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-a]carbazole (PubChem CID 147816252) has the molecular formula C28H25N2O+ and a molecular weight of 405.52 g/mol. Its IUPAC name is 9,12-dimethyl-10-(1,4,5-trimethylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-a]carbazole.
| Compound Name | 9,12-dimethyl-10-(1,4,5-trimethylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-a]carbazole |
|---|---|
| PubChem CID | 147816252 |
| Molecular Formula | C28H25N2O+ |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 9,12-dimethyl-10-(1,4,5-trimethylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-a]carbazole |
| SMILES | Cc1cc(-c2c(C)ccc3c2oc2c3ccc3c4ccccc4n(C)c32)[n+](C)cc1C |
| InChI | InChI=1S/C28H25N2O/c1-16-10-11-21-22-13-12-20-19-8-6-7-9-23(19)30(5)26(20)28(22)31-27(21)25(16)24-14-17(2)18(3)15-29(24)4/h6-15H,1-5H3/q+1 |
| InChIKey | QCTNVRYQVBFMNB-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|