C35H31GeN2O+ — CID 172542690
[4-isocyano-7-methyl-6-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]dibenzofuran-3-yl]-methyl-diphenylgermane (PubChem CID 172542690) has the molecular formula C35H31GeN2O+ and a molecular weight of 574.29 g/mol. Its IUPAC name is [4-isocyano-7-methyl-6-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]dibenzofuran-3-yl]-methyl-diphenylgermane.
| Compound Name | [4-isocyano-7-methyl-6-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]dibenzofuran-3-yl]-methyl-diphenylgermane |
|---|---|
| PubChem CID | 172542690 |
| Molecular Formula | C35H31GeN2O+ |
| Molecular Weight | 574.29 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | [4-isocyano-7-methyl-6-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]dibenzofuran-3-yl]-methyl-diphenylgermane |
| SMILES | [2H]C([2H])([2H])c1cc(-c2c(C)ccc3c2oc2c([N+]#[C-])c([Ge](C)(c4ccccc4)c4ccccc4)ccc23)[n+](C)cc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C35H31GeN2O/c1-23-17-18-28-29-19-20-30(36(4,26-13-9-7-10-14-26)27-15-11-8-12-16-27)33(37-5)35(29)39-34(28)32(23)31-21-24(2)25(3)22-38(31)6/h7-22H,1-4,6H3/q+1/i2D3,3D3 |
| InChIKey | PRRIVQDBIQWJHG-XERRXZQWSA-N |
| XLogP | 6.65 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.29 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|