C28H23N2O+ — CID 176823590
7-methyl-8-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-10-oxa-12-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaene (PubChem CID 176823590) has the molecular formula C28H23N2O+ and a molecular weight of 409.54 g/mol. Its IUPAC name is 7-methyl-8-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-10-oxa-12-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaene.
| Compound Name | 7-methyl-8-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-10-oxa-12-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaene |
|---|---|
| PubChem CID | 176823590 |
| Molecular Formula | C28H23N2O+ |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 7-methyl-8-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-10-oxa-12-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaene |
| SMILES | [2H]C([2H])([2H])c1cc(-c2c(C)ccc3c2oc2nc4c(ccc5ccccc54)cc23)[n+](C)cc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C28H23N2O/c1-16-9-12-22-23-14-20-11-10-19-7-5-6-8-21(19)26(20)29-28(23)31-27(22)25(16)24-13-17(2)18(3)15-30(24)4/h5-15H,1-4H3/q+1/i2D3,3D3 |
| InChIKey | OYZYPUJTWNHXEQ-XERRXZQWSA-N |
| XLogP | 6.70 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|