C38H33N2OSi+ — CID 172542803
[7-methyl-8-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridin-2-yl]-triphenylsilane (PubChem CID 172542803) has the molecular formula C38H33N2OSi+ and a molecular weight of 567.82 g/mol. Its IUPAC name is [7-methyl-8-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridin-2-yl]-triphenylsilane.
| Compound Name | [7-methyl-8-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridin-2-yl]-triphenylsilane |
|---|---|
| PubChem CID | 172542803 |
| Molecular Formula | C38H33N2OSi+ |
| Molecular Weight | 567.82 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | [7-methyl-8-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridin-2-yl]-triphenylsilane |
| SMILES | [2H]C([2H])([2H])c1cc(-c2c(C)ccc3c2oc2nc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)ccc23)[n+](C)cc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C38H33N2OSi/c1-26-20-21-32-33-22-23-35(39-38(33)41-37(32)36(26)34-24-27(2)28(3)25-40(34)4)42(29-14-8-5-9-15-29,30-16-10-6-11-17-30)31-18-12-7-13-19-31/h5-25H,1-4H3/q+1/i2D3,3D3 |
| InChIKey | PQHXVVSXZSWZRJ-XERRXZQWSA-N |
| XLogP | 5.78 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.82 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|