C24H21N2O+ — CID 159101602
8-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-9-methyl-[1]benzofuro[2,3-c]isoquinoline (PubChem CID 159101602) has the molecular formula C24H21N2O+ and a molecular weight of 356.46 g/mol. Its IUPAC name is 8-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-9-methyl-[1]benzofuro[2,3-c]isoquinoline.
| Compound Name | 8-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-9-methyl-[1]benzofuro[2,3-c]isoquinoline |
|---|---|
| PubChem CID | 159101602 |
| Molecular Formula | C24H21N2O+ |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 8-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-9-methyl-[1]benzofuro[2,3-c]isoquinoline |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2c(C)ccc3c2oc2ncc4ccccc4c23)cc1C |
| InChI | InChI=1S/C24H21N2O/c1-14-9-10-19-22-18-8-6-5-7-17(18)12-25-24(22)27-23(19)21(14)20-11-15(2)16(3)13-26(20)4/h5-13H,1-4H3/q+1/i3D3 |
| InChIKey | WLLRQKCLHLSTHR-HPRDVNIFSA-N |
| XLogP | 5.55 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|