C26H21N2O2+ — CID 159507953
16-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-17-methyl-9,14-dioxa-4-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15(20),16,18-nonaene (PubChem CID 159507953) has the molecular formula C26H21N2O2+ and a molecular weight of 396.48 g/mol. Its IUPAC name is 16-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-17-methyl-9,14-dioxa-4-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15(20),16,18-nonaene.
| Compound Name | 16-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-17-methyl-9,14-dioxa-4-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 159507953 |
| Molecular Formula | C26H21N2O2+ |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 16-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-17-methyl-9,14-dioxa-4-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15(20),16,18-nonaene |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2c(C)ccc3c2oc2ccc4oc5cccnc5c4c23)cc1C |
| InChI | InChI=1S/C26H21N2O2/c1-14-7-8-17-23-19(9-10-20-24(23)25-21(29-20)6-5-11-27-25)30-26(17)22(14)18-12-15(2)16(3)13-28(18)4/h5-13H,1-4H3/q+1/i3D3 |
| InChIKey | UGOUKFVUNWMELZ-HPRDVNIFSA-N |
| XLogP | 6.30 |
| TPSA | 43.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|