C26H25N2O+ — CID 158696898
9-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-2,3,8-trimethyl-[1]benzofuro[3,2-g]quinoline (PubChem CID 158696898) has the molecular formula C26H25N2O+ and a molecular weight of 384.52 g/mol. Its IUPAC name is 9-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-2,3,8-trimethyl-[1]benzofuro[3,2-g]quinoline.
| Compound Name | 9-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-2,3,8-trimethyl-[1]benzofuro[3,2-g]quinoline |
|---|---|
| PubChem CID | 158696898 |
| Molecular Formula | C26H25N2O+ |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 9-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-2,3,8-trimethyl-[1]benzofuro[3,2-g]quinoline |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2c(C)ccc3c2oc2cc4nc(C)c(C)cc4cc23)cc1C |
| InChI | InChI=1S/C26H25N2O/c1-14-7-8-20-21-11-19-9-16(3)18(5)27-22(19)12-24(21)29-26(20)25(14)23-10-15(2)17(4)13-28(23)6/h7-13H,1-6H3/q+1/i4D3 |
| InChIKey | FIJTYGSNXPOHCI-GKOSEXJESA-N |
| XLogP | 6.17 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|