C21H19FNO+ — CID 177273062
2-(6-deuterio-7-fluoro-3-methyldibenzofuran-4-yl)-1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium (PubChem CID 177273062) has the molecular formula C21H19FNO+ and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-(6-deuterio-7-fluoro-3-methyldibenzofuran-4-yl)-1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 2-(6-deuterio-7-fluoro-3-methyldibenzofuran-4-yl)-1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 177273062 |
| Molecular Formula | C21H19FNO+ |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 2-(6-deuterio-7-fluoro-3-methyldibenzofuran-4-yl)-1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]c1c(F)ccc2c1oc1c(-c3cc(C([2H])([2H])[2H])c(C([2H])([2H])[2H])c[n+]3C)c(C)ccc12 |
| InChI | InChI=1S/C21H19FNO/c1-12-5-7-17-16-8-6-15(22)10-19(16)24-21(17)20(12)18-9-13(2)14(3)11-23(18)4/h5-11H,1-4H3/q+1/i2D3,3D3,10D |
| InChIKey | QKKUHPRSZWQHGQ-SNQAWNDDSA-N |
| XLogP | 5.14 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|