C19H14F2NO+ — CID 159857293
5-fluoro-2-(7-fluoro-3-methyldibenzofuran-4-yl)-1-methylpyridin-1-ium (PubChem CID 159857293) has the molecular formula C19H14F2NO+ and a molecular weight of 310.32 g/mol. Its IUPAC name is 5-fluoro-2-(7-fluoro-3-methyldibenzofuran-4-yl)-1-methylpyridin-1-ium.
| Compound Name | 5-fluoro-2-(7-fluoro-3-methyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 159857293 |
| Molecular Formula | C19H14F2NO+ |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 5-fluoro-2-(7-fluoro-3-methyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3cc(F)ccc32)c1-c1ccc(F)c[n+]1C |
| InChI | InChI=1S/C19H14F2NO/c1-11-3-6-15-14-7-4-12(20)9-17(14)23-19(15)18(11)16-8-5-13(21)10-22(16)2/h3-10H,1-2H3/q+1 |
| InChIKey | JZCZTROJSJFUGY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|