C32H20FN2O2+ — CID 169282673
4-dibenzofuran-3-yl-6-(5-fluoro-1-methylpyridin-1-ium-2-yl)-7-methyldibenzofuran-3-carbonitrile (PubChem CID 169282673) has the molecular formula C32H20FN2O2+ and a molecular weight of 483.52 g/mol. Its IUPAC name is 4-dibenzofuran-3-yl-6-(5-fluoro-1-methylpyridin-1-ium-2-yl)-7-methyldibenzofuran-3-carbonitrile.
| Compound Name | 4-dibenzofuran-3-yl-6-(5-fluoro-1-methylpyridin-1-ium-2-yl)-7-methyldibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 169282673 |
| Molecular Formula | C32H20FN2O2+ |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 4-dibenzofuran-3-yl-6-(5-fluoro-1-methylpyridin-1-ium-2-yl)-7-methyldibenzofuran-3-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5c(c4)oc4ccccc45)c(C#N)ccc32)c1-c1ccc(F)c[n+]1C |
| InChI | InChI=1S/C32H20FN2O2/c1-18-7-11-24-25-13-9-20(16-34)30(19-8-12-23-22-5-3-4-6-27(22)36-28(23)15-19)32(25)37-31(24)29(18)26-14-10-21(33)17-35(26)2/h3-15,17H,1-2H3/q+1 |
| InChIKey | DRURFYBDVYIWET-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 53.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|