C32H22FN2O+ — CID 169282714
9-(5-fluoro-1-methylpyridin-1-ium-2-yl)-8-methyl-4-(4-phenylphenyl)dibenzofuran-3-carbonitrile (PubChem CID 169282714) has the molecular formula C32H22FN2O+ and a molecular weight of 469.54 g/mol. Its IUPAC name is 9-(5-fluoro-1-methylpyridin-1-ium-2-yl)-8-methyl-4-(4-phenylphenyl)dibenzofuran-3-carbonitrile.
| Compound Name | 9-(5-fluoro-1-methylpyridin-1-ium-2-yl)-8-methyl-4-(4-phenylphenyl)dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 169282714 |
| Molecular Formula | C32H22FN2O+ |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 9-(5-fluoro-1-methylpyridin-1-ium-2-yl)-8-methyl-4-(4-phenylphenyl)dibenzofuran-3-carbonitrile |
| SMILES | Cc1ccc2oc3c(-c4ccc(-c5ccccc5)cc4)c(C#N)ccc3c2c1-c1ccc(F)c[n+]1C |
| InChI | InChI=1S/C32H22FN2O/c1-20-8-17-28-31(29(20)27-16-14-25(33)19-35(27)2)26-15-13-24(18-34)30(32(26)36-28)23-11-9-22(10-12-23)21-6-4-3-5-7-21/h3-17,19H,1-2H3/q+1 |
| InChIKey | HPJGRNVFRJNRJM-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|