C35H31GeN2O+ — CID 164849540
7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-(4-phenylphenyl)-9-trimethylgermyldibenzofuran-3-carbonitrile (PubChem CID 164849540) has the molecular formula C35H31GeN2O+ and a molecular weight of 568.26 g/mol. Its IUPAC name is 7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-(4-phenylphenyl)-9-trimethylgermyldibenzofuran-3-carbonitrile.
| Compound Name | 7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-(4-phenylphenyl)-9-trimethylgermyldibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 164849540 |
| Molecular Formula | C35H31GeN2O+ |
| Molecular Weight | 568.26 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | 7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-(4-phenylphenyl)-9-trimethylgermyldibenzofuran-3-carbonitrile |
| SMILES | Cc1cc([Ge](C)(C)C)c2c(oc3c(-c4ccc(-c5ccccc5)cc4)c(C#N)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C35H31GeN2O/c1-23-21-29(36(2,3)4)33-28-19-18-27(22-37)32(26-16-14-25(15-17-26)24-11-7-6-8-12-24)34(28)39-35(33)31(23)30-13-9-10-20-38(30)5/h6-21H,1-5H3/q+1 |
| InChIKey | ZRZIMPDOIAUFQP-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.26 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|