C35H30FGeN2O+ — CID 169282789
6-(4-fluoro-1-methyl-5-trimethylgermylpyridin-1-ium-2-yl)-7-methyl-4-(4-phenylphenyl)dibenzofuran-3-carbonitrile (PubChem CID 169282789) has the molecular formula C35H30FGeN2O+ and a molecular weight of 586.25 g/mol. Its IUPAC name is 6-(4-fluoro-1-methyl-5-trimethylgermylpyridin-1-ium-2-yl)-7-methyl-4-(4-phenylphenyl)dibenzofuran-3-carbonitrile.
| Compound Name | 6-(4-fluoro-1-methyl-5-trimethylgermylpyridin-1-ium-2-yl)-7-methyl-4-(4-phenylphenyl)dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 169282789 |
| Molecular Formula | C35H30FGeN2O+ |
| Molecular Weight | 586.25 g/mol |
| Exact Mass | 587.15 |
| IUPAC Name | 6-(4-fluoro-1-methyl-5-trimethylgermylpyridin-1-ium-2-yl)-7-methyl-4-(4-phenylphenyl)dibenzofuran-3-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(-c4ccc(-c5ccccc5)cc4)c(C#N)ccc32)c1-c1cc(F)c([Ge](C)(C)C)c[n+]1C |
| InChI | InChI=1S/C35H30FGeN2O/c1-22-11-17-27-28-18-16-26(20-38)33(25-14-12-24(13-15-25)23-9-7-6-8-10-23)35(28)40-34(27)32(22)31-19-29(36)30(21-39(31)5)37(2,3)4/h6-19,21H,1-5H3/q+1 |
| InChIKey | PIWHZNOFASLNTJ-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.25 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|